C12H14Cl2 — CID 23186111
1-tert-butyl-4-(2,2-dichloroethenyl)benzene (PubChem CID 23186111) has the molecular formula C12H14Cl2 and a molecular weight of 229.15 g/mol. Its IUPAC name is 1-tert-butyl-4-(2,2-dichloroethenyl)benzene.
| Compound Name | 1-tert-butyl-4-(2,2-dichloroethenyl)benzene |
|---|---|
| PubChem CID | 23186111 |
| Molecular Formula | C12H14Cl2 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-tert-butyl-4-(2,2-dichloroethenyl)benzene |
| SMILES | CC(C)(C)c1ccc(C=C(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H14Cl2/c1-12(2,3)10-6-4-9(5-7-10)8-11(13)14/h4-8H,1-3H3 |
| InChIKey | MEQUFIXNSYSTGH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |