C21H18ClF4N3O — CID 162586147
2-(aminomethylidene)-3-(4-chlorophenyl)imino-N-[(1S)-1-[4-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]butanamide (PubChem CID 162586147) has the molecular formula C21H18ClF4N3O and a molecular weight of 439.84 g/mol. Its IUPAC name is 2-(aminomethylidene)-3-(4-chlorophenyl)imino-N-[(1S)-1-[4-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]butanamide.
| Compound Name | 2-(aminomethylidene)-3-(4-chlorophenyl)imino-N-[(1S)-1-[4-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]butanamide |
|---|---|
| PubChem CID | 162586147 |
| Molecular Formula | C21H18ClF4N3O |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-(aminomethylidene)-3-(4-chlorophenyl)imino-N-[(1S)-1-[4-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]butanamide |
| SMILES | C=C[C@H](NC(=O)C(=CN)/C(C)=N/c1ccc(Cl)cc1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18ClF4N3O/c1-3-19(13-4-9-18(23)17(10-13)21(24,25)26)29-20(30)16(11-27)12(2)28-15-7-5-14(22)6-8-15/h3-11,19H,1,27H2,2H3,(H,29,30)/b16-11?,28-12+/t19-/m0/s1 |
| InChIKey | YSAYGSAYPUKATJ-GOEPUNHUSA-N |
| XLogP | 5.48 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|