C17H14ClF4NO3 — CID 21388403
2-(4-chlorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-(2-hydroxyethyl)acetamide (PubChem CID 21388403) has the molecular formula C17H14ClF4NO3 and a molecular weight of 391.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 21388403 |
| Molecular Formula | C17H14ClF4NO3 |
| Molecular Weight | 391.75 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(NCCO)C(Oc1ccc(F)c(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClF4NO3/c18-11-3-1-10(2-4-11)15(16(25)23-7-8-24)26-12-5-6-14(19)13(9-12)17(20,21)22/h1-6,9,15,24H,7-8H2,(H,23,25) |
| InChIKey | KWUGJYURTVGNHP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |