C20H21F4NO3 — CID 156827594
N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanamide;ethane (PubChem CID 156827594) has the molecular formula C20H21F4NO3 and a molecular weight of 399.38 g/mol. Its IUPAC name is N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanamide;ethane.
| Compound Name | N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanamide;ethane |
|---|---|
| PubChem CID | 156827594 |
| Molecular Formula | C20H21F4NO3 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanamide;ethane |
| SMILES | CC.O=CCC(Oc1ccc(F)c(C(F)(F)F)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H15F4NO3.C2H6/c19-15-7-6-13(10-14(15)18(20,21)22)26-16(8-9-24)17(25)23-11-12-4-2-1-3-5-12;1-2/h1-7,9-10,16H,8,11H2,(H,23,25);1-2H3 |
| InChIKey | NROGFPVLNJFKSC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|