C19H16F5NO4 — CID 54387512
2-acetamidoethyl 2-(4-fluorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]acetate (PubChem CID 54387512) has the molecular formula C19H16F5NO4 and a molecular weight of 417.33 g/mol. Its IUPAC name is 2-acetamidoethyl 2-(4-fluorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]acetate.
| Compound Name | 2-acetamidoethyl 2-(4-fluorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 54387512 |
| Molecular Formula | C19H16F5NO4 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-acetamidoethyl 2-(4-fluorophenyl)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]acetate |
| SMILES | CC(=O)NCCOC(=O)C(Oc1ccc(F)c(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F5NO4/c1-11(26)25-8-9-28-18(27)17(12-2-4-13(20)5-3-12)29-14-6-7-16(21)15(10-14)19(22,23)24/h2-7,10,17H,8-9H2,1H3,(H,25,26) |
| InChIKey | VEGYRUFMTJJNGB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|