C10H5F7O3 — CID 118593360
[4-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroethyl carbonate (PubChem CID 118593360) has the molecular formula C10H5F7O3 and a molecular weight of 306.13 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroethyl carbonate.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroethyl carbonate |
|---|---|
| PubChem CID | 118593360 |
| Molecular Formula | C10H5F7O3 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroethyl carbonate |
| SMILES | O=C(OCC(F)(F)F)Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F7O3/c11-7-2-1-5(3-6(7)10(15,16)17)20-8(18)19-4-9(12,13)14/h1-3H,4H2 |
| InChIKey | OBRJRPMAQDQRKV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|