C11H10F4O4 — CID 102746826
3-[4-fluoro-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methylpropanoic acid (PubChem CID 102746826) has the molecular formula C11H10F4O4 and a molecular weight of 282.19 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 102746826 |
| Molecular Formula | C11H10F4O4 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(COc1ccc(F)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C11H10F4O4/c1-10(18,9(16)17)5-19-6-2-3-8(12)7(4-6)11(13,14)15/h2-4,18H,5H2,1H3,(H,16,17) |
| InChIKey | ZWUYSKRMWFTNOH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |