C12H12F4O4 — CID 102747684
2-ethoxy-3-[4-fluoro-3-(trifluoromethyl)phenoxy]propanoic acid (PubChem CID 102747684) has the molecular formula C12H12F4O4 and a molecular weight of 296.22 g/mol. Its IUPAC name is 2-ethoxy-3-[4-fluoro-3-(trifluoromethyl)phenoxy]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-fluoro-3-(trifluoromethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 102747684 |
| Molecular Formula | C12H12F4O4 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-ethoxy-3-[4-fluoro-3-(trifluoromethyl)phenoxy]propanoic acid |
| SMILES | CCOC(COc1ccc(F)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H12F4O4/c1-2-19-10(11(17)18)6-20-7-3-4-9(13)8(5-7)12(14,15)16/h3-5,10H,2,6H2,1H3,(H,17,18) |
| InChIKey | RHVLGDXFDNBHMW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |