C11H8F4O4 — CID 156827583
(2S)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanoic acid (PubChem CID 156827583) has the molecular formula C11H8F4O4 and a molecular weight of 280.17 g/mol. Its IUPAC name is (2S)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 156827583 |
| Molecular Formula | C11H8F4O4 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (2S)-2-[4-fluoro-3-(trifluoromethyl)phenoxy]-4-oxobutanoic acid |
| SMILES | O=CC[C@H](Oc1ccc(F)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C11H8F4O4/c12-8-2-1-6(5-7(8)11(13,14)15)19-9(3-4-16)10(17)18/h1-2,4-5,9H,3H2,(H,17,18)/t9-/m0/s1 |
| InChIKey | NGOAEPHDCKKLGR-VIFPVBQESA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|