C25H25FO5 — CID 54423799
methyl 2-(3,4-dimethylphenoxy)-2-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]acetate (PubChem CID 54423799) has the molecular formula C25H25FO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl 2-(3,4-dimethylphenoxy)-2-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]acetate.
| Compound Name | methyl 2-(3,4-dimethylphenoxy)-2-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 54423799 |
| Molecular Formula | C25H25FO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | methyl 2-(3,4-dimethylphenoxy)-2-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]acetate |
| SMILES | COC(=O)C(Oc1ccc(C)c(C)c1)c1ccc(OCCOc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H25FO5/c1-17-4-9-23(16-18(17)2)31-24(25(27)28-3)19-5-10-21(11-6-19)29-14-15-30-22-12-7-20(26)8-13-22/h4-13,16,24H,14-15H2,1-3H3 |
| InChIKey | WCQHKPYJYUIPHG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|