C12H12F4O2 — CID 107289983
2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutanoic acid (PubChem CID 107289983) has the molecular formula C12H12F4O2 and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutanoic acid.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 107289983 |
| Molecular Formula | C12H12F4O2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F4O2/c1-6(2)10(11(17)18)7-3-4-9(13)8(5-7)12(14,15)16/h3-6,10H,1-2H3,(H,17,18) |
| InChIKey | HVYBIUYOVKFMGH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |