C11H9ClF4O2 — CID 103440305
4-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 103440305) has the molecular formula C11H9ClF4O2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 4-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 103440305 |
| Molecular Formula | C11H9ClF4O2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | O=C(O)CCC(Cl)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9ClF4O2/c12-8(2-4-10(17)18)6-1-3-9(13)7(5-6)11(14,15)16/h1,3,5,8H,2,4H2,(H,17,18) |
| InChIKey | MWGUTLNATLUMNK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|