C10H8ClF4NO — CID 104513169
2-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 104513169) has the molecular formula C10H8ClF4NO and a molecular weight of 269.63 g/mol. Its IUPAC name is 2-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 104513169 |
| Molecular Formula | C10H8ClF4NO |
| Molecular Weight | 269.63 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | NC(=O)C(Cl)Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8ClF4NO/c11-7(9(16)17)4-5-1-2-8(12)6(3-5)10(13,14)15/h1-3,7H,4H2,(H2,16,17) |
| InChIKey | BGHAVBJHZOFGCF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|