C10H8F4O — CID 143164725
3-[4-fluoro-3-(trifluoromethyl)phenyl]prop-1-en-2-ol (PubChem CID 143164725) has the molecular formula C10H8F4O and a molecular weight of 220.16 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenyl]prop-1-en-2-ol.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 143164725 |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]prop-1-en-2-ol |
| SMILES | C=C(O)Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F4O/c1-6(15)4-7-2-3-9(11)8(5-7)10(12,13)14/h2-3,5,15H,1,4H2 |
| InChIKey | XIQZEOUVXAKHNM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|