C8H6F4O3S — CID 141423589
[4-fluoro-3-(trifluoromethyl)phenyl]methanesulfonic acid (PubChem CID 141423589) has the molecular formula C8H6F4O3S and a molecular weight of 258.19 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]methanesulfonic acid.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 141423589 |
| Molecular Formula | C8H6F4O3S |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]methanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H6F4O3S/c9-7-2-1-5(4-16(13,14)15)3-6(7)8(10,11)12/h1-3H,4H2,(H,13,14,15) |
| InChIKey | BCYDBDKSCUBYOM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|