C10H8F4O — CID 107290790
2-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]oxirane (PubChem CID 107290790) has the molecular formula C10H8F4O and a molecular weight of 220.16 g/mol. Its IUPAC name is 2-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]oxirane.
| Compound Name | 2-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]oxirane |
|---|---|
| PubChem CID | 107290790 |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]oxirane |
| SMILES | Fc1ccc(CC2CO2)cc1C(F)(F)F |
| InChI | InChI=1S/C10H8F4O/c11-9-2-1-6(3-7-5-15-7)4-8(9)10(12,13)14/h1-2,4,7H,3,5H2 |
| InChIKey | WPBCSHOEXNGANB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|