C20H12F8S — CID 156907937
2,5-bis[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene (PubChem CID 156907937) has the molecular formula C20H12F8S and a molecular weight of 436.37 g/mol. Its IUPAC name is 2,5-bis[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene.
| Compound Name | 2,5-bis[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene |
|---|---|
| PubChem CID | 156907937 |
| Molecular Formula | C20H12F8S |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2,5-bis[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene |
| SMILES | Fc1ccc(Cc2ccc(Cc3ccc(F)c(C(F)(F)F)c3)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H12F8S/c21-17-5-1-11(9-15(17)19(23,24)25)7-13-3-4-14(29-13)8-12-2-6-18(22)16(10-12)20(26,27)28/h1-6,9-10H,7-8H2 |
| InChIKey | HILUFWKKODVNFL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |