C13H14Cl2F4O2 — CID 160712634
1-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propan-2-ol;(2R)-2-(chloromethyl)oxirane (PubChem CID 160712634) has the molecular formula C13H14Cl2F4O2 and a molecular weight of 349.15 g/mol. Its IUPAC name is 1-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propan-2-ol;(2R)-2-(chloromethyl)oxirane.
| Compound Name | 1-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propan-2-ol;(2R)-2-(chloromethyl)oxirane |
|---|---|
| PubChem CID | 160712634 |
| Molecular Formula | C13H14Cl2F4O2 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-chloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]propan-2-ol;(2R)-2-(chloromethyl)oxirane |
| SMILES | ClC[C@H]1CO1.OC(CCl)Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF4O.C3H5ClO/c11-5-7(16)3-6-1-2-9(12)8(4-6)10(13,14)15;4-1-3-2-5-3/h1-2,4,7,16H,3,5H2;3H,1-2H2/t;3-/m.0/s1 |
| InChIKey | RSBFUQYZARVECC-HVDRVSQOSA-N |
| XLogP | 3.61 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|