C12H13ClF4O — CID 114198198
4-(1-chloro-4-methoxybutyl)-1-fluoro-2-(trifluoromethyl)benzene (PubChem CID 114198198) has the molecular formula C12H13ClF4O and a molecular weight of 284.68 g/mol. Its IUPAC name is 4-(1-chloro-4-methoxybutyl)-1-fluoro-2-(trifluoromethyl)benzene.
| Compound Name | 4-(1-chloro-4-methoxybutyl)-1-fluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 114198198 |
| Molecular Formula | C12H13ClF4O |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-(1-chloro-4-methoxybutyl)-1-fluoro-2-(trifluoromethyl)benzene |
| SMILES | COCCCC(Cl)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF4O/c1-18-6-2-3-10(13)8-4-5-11(14)9(7-8)12(15,16)17/h4-5,7,10H,2-3,6H2,1H3 |
| InChIKey | RTESZSMMODVOAY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|