C25H20F6O2 — CID 87697048
2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylbutanoic acid (PubChem CID 87697048) has the molecular formula C25H20F6O2 and a molecular weight of 466.42 g/mol. Its IUPAC name is 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylbutanoic acid.
| Compound Name | 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87697048 |
| Molecular Formula | C25H20F6O2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)c1ccc(-c2ccc(C(F)(F)F)cc2)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H20F6O2/c1-14(2)22(23(32)33)17-7-12-20(15-3-8-18(9-4-15)24(26,27)28)21(13-17)16-5-10-19(11-6-16)25(29,30)31/h3-14,22H,1-2H3,(H,32,33) |
| InChIKey | LQIYWBHJWBTVAX-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |