About 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid
2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid (PubChem CID 87697057) has the molecular formula C26H20F6O2
and a molecular weight of 478.43 g/mol. Its IUPAC name is 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid.
Molecular Properties
| Compound Name | 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid |
| PubChem CID | 87697057 |
| Molecular Formula | C26H20F6O2 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid |
| SMILES | O=C(O)C(CC1CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H20F6O2/c27-25(28,29)19-8-3-16(4-9-19)21-12-7-18(23(24(33)34)13-15-1-2-15)14-22(21)17-5-10-20(11-6-17)26(30,31)32/h3-12,14-15,23H,1-2,13H2,(H,33,34) |
| InChIKey | RQIIJOOLFPRAAU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid?
The IUPAC name of 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid (CID 87697057) is 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid.
What is the SMILES notation for 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid?
The canonical SMILES for 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid is O=C(O)C(CC1CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)c(-c2ccc(C(F)(F)F)cc2)c1.
What is the InChIKey of 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid?
The InChIKey is RQIIJOOLFPRAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F6O2/c27-25(28,29)19-8-3-16(4-9-19)21-12-7-18(23(24(33)34)13-15-1-2-15)14-22(21)17-5-10-20(11-6-17)26(30,31)32/h3-12,14-15,23H,1-2,13H2,(H,33,34).
What are the key properties of 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid?
2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid has a molecular weight of 478.43 g/mol, XLogP of 8.03, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoic acid is sourced from PubChem (CID 87697057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).