C36H43NO4 — CID 10721462
1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(benzhydrylideneamino)-3-phenylpentanedioate (PubChem CID 10721462) has the molecular formula C36H43NO4 and a molecular weight of 553.74 g/mol. Its IUPAC name is 1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(benzhydrylideneamino)-3-phenylpentanedioate.
| Compound Name | 1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(benzhydrylideneamino)-3-phenylpentanedioate |
|---|---|
| PubChem CID | 10721462 |
| Molecular Formula | C36H43NO4 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(benzhydrylideneamino)-3-phenylpentanedioate |
| SMILES | CCOC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C36H43NO4/c1-5-40-36(39)35(37-34(28-17-11-7-12-18-28)29-19-13-8-14-20-29)31(27-15-9-6-10-16-27)24-33(38)41-32-23-26(4)21-22-30(32)25(2)3/h6-20,25-26,30-32,35H,5,21-24H2,1-4H3/t26-,30+,31+,32-,35-/m1/s1 |
| InChIKey | LYWYCDAWXAJBPB-DMWXZZJESA-N |
| XLogP | 7.63 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|