C24H21NO3 — CID 101440460
(3R,4R)-4-nitro-1,3,5-triphenylhex-5-en-1-one (PubChem CID 101440460) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (3R,4R)-4-nitro-1,3,5-triphenylhex-5-en-1-one.
| Compound Name | (3R,4R)-4-nitro-1,3,5-triphenylhex-5-en-1-one |
|---|---|
| PubChem CID | 101440460 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3R,4R)-4-nitro-1,3,5-triphenylhex-5-en-1-one |
| SMILES | C=C(c1ccccc1)[C@@H]([C@H](CC(=O)c1ccccc1)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C24H21NO3/c1-18(19-11-5-2-6-12-19)24(25(27)28)22(20-13-7-3-8-14-20)17-23(26)21-15-9-4-10-16-21/h2-16,22,24H,1,17H2/t22-,24+/m1/s1 |
| InChIKey | JICTZJJHKAOWLN-VWNXMTODSA-N |
| XLogP | 5.40 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|