C18H17NO4 — CID 132837335
(5R)-6-nitro-1,5-diphenylhexane-1,3-dione (PubChem CID 132837335) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (5R)-6-nitro-1,5-diphenylhexane-1,3-dione.
| Compound Name | (5R)-6-nitro-1,5-diphenylhexane-1,3-dione |
|---|---|
| PubChem CID | 132837335 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (5R)-6-nitro-1,5-diphenylhexane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccccc1)C[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c20-17(12-18(21)15-9-5-2-6-10-15)11-16(13-19(22)23)14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-/m0/s1 |
| InChIKey | NQYCUWSPFIEBGD-INIZCTEOSA-N |
| XLogP | 3.28 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|