C18H19NO3 — CID 132837349
(5R)-6-nitro-1,5-diphenylhexan-3-one (PubChem CID 132837349) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (5R)-6-nitro-1,5-diphenylhexan-3-one.
| Compound Name | (5R)-6-nitro-1,5-diphenylhexan-3-one |
|---|---|
| PubChem CID | 132837349 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (5R)-6-nitro-1,5-diphenylhexan-3-one |
| SMILES | O=C(CCc1ccccc1)C[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c20-18(12-11-15-7-3-1-4-8-15)13-17(14-19(21)22)16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m0/s1 |
| InChIKey | ZRYVTRNDLYKTAX-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|