C16H15NO3 — CID 163572422
(3S)-4-nitro-1,3-diphenylbutan-2-one (PubChem CID 163572422) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (3S)-4-nitro-1,3-diphenylbutan-2-one.
| Compound Name | (3S)-4-nitro-1,3-diphenylbutan-2-one |
|---|---|
| PubChem CID | 163572422 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3S)-4-nitro-1,3-diphenylbutan-2-one |
| SMILES | O=C(Cc1ccccc1)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c18-16(11-13-7-3-1-4-8-13)15(12-17(19)20)14-9-5-2-6-10-14/h1-10,15H,11-12H2/t15-/m1/s1 |
| InChIKey | GANXKLMEDQLIOA-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|