C32H26O4 — CID 124578428
(3S,6R)-1,3,6,8-tetraphenyloctane-2,4,5,7-tetrone (PubChem CID 124578428) has the molecular formula C32H26O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is (3S,6R)-1,3,6,8-tetraphenyloctane-2,4,5,7-tetrone.
| Compound Name | (3S,6R)-1,3,6,8-tetraphenyloctane-2,4,5,7-tetrone |
|---|---|
| PubChem CID | 124578428 |
| Molecular Formula | C32H26O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (3S,6R)-1,3,6,8-tetraphenyloctane-2,4,5,7-tetrone |
| SMILES | O=C(Cc1ccccc1)[C@H](C(=O)C(=O)[C@H](C(=O)Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H26O4/c33-27(21-23-13-5-1-6-14-23)29(25-17-9-3-10-18-25)31(35)32(36)30(26-19-11-4-12-20-26)28(34)22-24-15-7-2-8-16-24/h1-20,29-30H,21-22H2/t29-,30+ |
| InChIKey | CLHKZYQHDMQYMD-RNPORBBMSA-N |
| XLogP | 5.32 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|