C17H17BrO — CID 6932716
(3S)-5-bromo-1,3-diphenylpentan-2-one (PubChem CID 6932716) has the molecular formula C17H17BrO and a molecular weight of 317.23 g/mol. Its IUPAC name is (3S)-5-bromo-1,3-diphenylpentan-2-one.
| Compound Name | (3S)-5-bromo-1,3-diphenylpentan-2-one |
|---|---|
| PubChem CID | 6932716 |
| Molecular Formula | C17H17BrO |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (3S)-5-bromo-1,3-diphenylpentan-2-one |
| SMILES | O=C(Cc1ccccc1)[C@@H](CCBr)c1ccccc1 |
| InChI | InChI=1S/C17H17BrO/c18-12-11-16(15-9-5-2-6-10-15)17(19)13-14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-/m0/s1 |
| InChIKey | OCGJLFHDCCWOBR-INIZCTEOSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|