C16H14O5 — CID 22605236
2,4-bis(3-hydroxyphenyl)-3-oxobutanoic acid (PubChem CID 22605236) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2,4-bis(3-hydroxyphenyl)-3-oxobutanoic acid.
| Compound Name | 2,4-bis(3-hydroxyphenyl)-3-oxobutanoic acid |
|---|---|
| PubChem CID | 22605236 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2,4-bis(3-hydroxyphenyl)-3-oxobutanoic acid |
| SMILES | O=C(O)C(C(=O)Cc1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C16H14O5/c17-12-5-1-3-10(7-12)8-14(19)15(16(20)21)11-4-2-6-13(18)9-11/h1-7,9,15,17-18H,8H2,(H,20,21) |
| InChIKey | XOSCCLXECRSKQY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|