C17H16O6 — CID 90858171
2-(3-hydroxyphenyl)-2-[2-(3-methoxyphenyl)acetyl]oxyacetic acid (PubChem CID 90858171) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-2-[2-(3-methoxyphenyl)acetyl]oxyacetic acid.
| Compound Name | 2-(3-hydroxyphenyl)-2-[2-(3-methoxyphenyl)acetyl]oxyacetic acid |
|---|---|
| PubChem CID | 90858171 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(3-hydroxyphenyl)-2-[2-(3-methoxyphenyl)acetyl]oxyacetic acid |
| SMILES | COc1cccc(CC(=O)OC(C(=O)O)c2cccc(O)c2)c1 |
| InChI | InChI=1S/C17H16O6/c1-22-14-7-2-4-11(8-14)9-15(19)23-16(17(20)21)12-5-3-6-13(18)10-12/h2-8,10,16,18H,9H2,1H3,(H,20,21) |
| InChIKey | ZHMCBKFXZYYCNX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |