About nitro 2-oxo-3-phenylpropanoate
nitro 2-oxo-3-phenylpropanoate (PubChem CID 54202175) has the molecular formula C9H7NO5
and a molecular weight of 209.16 g/mol. Its IUPAC name is nitro 2-oxo-3-phenylpropanoate.
Molecular Properties
| Compound Name | nitro 2-oxo-3-phenylpropanoate |
| PubChem CID | 54202175 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | nitro 2-oxo-3-phenylpropanoate |
| SMILES | O=C(Cc1ccccc1)C(=O)O[N+](=O)[O-] |
| InChI | InChI=1S/C9H7NO5/c11-8(9(12)15-10(13)14)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | PQAGWHLREKAHAE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro 2-oxo-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro 2-oxo-3-phenylpropanoate?
The IUPAC name of nitro 2-oxo-3-phenylpropanoate (CID 54202175) is nitro 2-oxo-3-phenylpropanoate.
What is the SMILES notation for nitro 2-oxo-3-phenylpropanoate?
The canonical SMILES for nitro 2-oxo-3-phenylpropanoate is O=C(Cc1ccccc1)C(=O)O[N+](=O)[O-].
What is the InChIKey of nitro 2-oxo-3-phenylpropanoate?
The InChIKey is PQAGWHLREKAHAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO5/c11-8(9(12)15-10(13)14)6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of nitro 2-oxo-3-phenylpropanoate?
nitro 2-oxo-3-phenylpropanoate has a molecular weight of 209.16 g/mol, XLogP of 0.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitro 2-oxo-3-phenylpropanoate is sourced from PubChem (CID 54202175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).