About nitro 2-oxo-2-phenylacetate
nitro 2-oxo-2-phenylacetate (PubChem CID 68906140) has the molecular formula C8H5NO5
and a molecular weight of 195.13 g/mol. Its IUPAC name is nitro 2-oxo-2-phenylacetate.
Molecular Properties
| Compound Name | nitro 2-oxo-2-phenylacetate |
| PubChem CID | 68906140 |
| Molecular Formula | C8H5NO5 |
| Molecular Weight | 195.13 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | nitro 2-oxo-2-phenylacetate |
| SMILES | O=C(O[N+](=O)[O-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C8H5NO5/c10-7(8(11)14-9(12)13)6-4-2-1-3-5-6/h1-5H |
| InChIKey | IABQHDYTDFARHU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.13 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro 2-oxo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro 2-oxo-2-phenylacetate?
The IUPAC name of nitro 2-oxo-2-phenylacetate (CID 68906140) is nitro 2-oxo-2-phenylacetate.
What is the SMILES notation for nitro 2-oxo-2-phenylacetate?
The canonical SMILES for nitro 2-oxo-2-phenylacetate is O=C(O[N+](=O)[O-])C(=O)c1ccccc1.
What is the InChIKey of nitro 2-oxo-2-phenylacetate?
The InChIKey is IABQHDYTDFARHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO5/c10-7(8(11)14-9(12)13)6-4-2-1-3-5-6/h1-5H.
What are the key properties of nitro 2-oxo-2-phenylacetate?
nitro 2-oxo-2-phenylacetate has a molecular weight of 195.13 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitro 2-oxo-2-phenylacetate is sourced from PubChem (CID 68906140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).