About phenyl 2-oxo-3-phenylpropanoate
phenyl 2-oxo-3-phenylpropanoate (PubChem CID 57172801) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is phenyl 2-oxo-3-phenylpropanoate.
Molecular Properties
| Compound Name | phenyl 2-oxo-3-phenylpropanoate |
| PubChem CID | 57172801 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | phenyl 2-oxo-3-phenylpropanoate |
| SMILES | O=C(Cc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H12O3/c16-14(11-12-7-3-1-4-8-12)15(17)18-13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | OUHUHUXZNNECRY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-oxo-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-oxo-3-phenylpropanoate?
The IUPAC name of phenyl 2-oxo-3-phenylpropanoate (CID 57172801) is phenyl 2-oxo-3-phenylpropanoate.
What is the SMILES notation for phenyl 2-oxo-3-phenylpropanoate?
The canonical SMILES for phenyl 2-oxo-3-phenylpropanoate is O=C(Cc1ccccc1)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-oxo-3-phenylpropanoate?
The InChIKey is OUHUHUXZNNECRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c16-14(11-12-7-3-1-4-8-12)15(17)18-13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of phenyl 2-oxo-3-phenylpropanoate?
phenyl 2-oxo-3-phenylpropanoate has a molecular weight of 240.26 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-oxo-3-phenylpropanoate is sourced from PubChem (CID 57172801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).