About butanoic acid;phenyl 2-phenylacetate
butanoic acid;phenyl 2-phenylacetate (PubChem CID 68544995) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is butanoic acid;phenyl 2-phenylacetate.
Molecular Properties
| Compound Name | butanoic acid;phenyl 2-phenylacetate |
| PubChem CID | 68544995 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | butanoic acid;phenyl 2-phenylacetate |
| SMILES | CCCC(=O)O.O=C(Cc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C14H12O2.C4H8O2/c15-14(11-12-7-3-1-4-8-12)16-13-9-5-2-6-10-13;1-2-3-4(5)6/h1-10H,11H2;2-3H2,1H3,(H,5,6) |
| InChIKey | VQMHEADFOBRZTI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze butanoic acid;phenyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;phenyl 2-phenylacetate?
The IUPAC name of butanoic acid;phenyl 2-phenylacetate (CID 68544995) is butanoic acid;phenyl 2-phenylacetate.
What is the SMILES notation for butanoic acid;phenyl 2-phenylacetate?
The canonical SMILES for butanoic acid;phenyl 2-phenylacetate is CCCC(=O)O.O=C(Cc1ccccc1)Oc1ccccc1.
What is the InChIKey of butanoic acid;phenyl 2-phenylacetate?
The InChIKey is VQMHEADFOBRZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C4H8O2/c15-14(11-12-7-3-1-4-8-12)16-13-9-5-2-6-10-13;1-2-3-4(5)6/h1-10H,11H2;2-3H2,1H3,(H,5,6).
What are the key properties of butanoic acid;phenyl 2-phenylacetate?
butanoic acid;phenyl 2-phenylacetate has a molecular weight of 300.35 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;phenyl 2-phenylacetate is sourced from PubChem (CID 68544995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).