C15H18O2 — CID 10353801
(3S)-3-[(2S)-1-oxo-1-phenylpropan-2-yl]cyclohexan-1-one (PubChem CID 10353801) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (3S)-3-[(2S)-1-oxo-1-phenylpropan-2-yl]cyclohexan-1-one.
| Compound Name | (3S)-3-[(2S)-1-oxo-1-phenylpropan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 10353801 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3S)-3-[(2S)-1-oxo-1-phenylpropan-2-yl]cyclohexan-1-one |
| SMILES | C[C@H](C(=O)c1ccccc1)[C@H]1CCCC(=O)C1 |
| InChI | InChI=1S/C15H18O2/c1-11(13-8-5-9-14(16)10-13)15(17)12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | KZRWVRSTUSMFRK-AAEUAGOBSA-N |
| XLogP | 3.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |