C15H20O2 — CID 101241233
2-[(1S,2R)-2-hydroxycyclohexyl]-1-phenylpropan-1-one (PubChem CID 101241233) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[(1S,2R)-2-hydroxycyclohexyl]-1-phenylpropan-1-one.
| Compound Name | 2-[(1S,2R)-2-hydroxycyclohexyl]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 101241233 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 2-[(1S,2R)-2-hydroxycyclohexyl]-1-phenylpropan-1-one |
| SMILES | CC(C(=O)c1ccccc1)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C15H20O2/c1-11(13-9-5-6-10-14(13)16)15(17)12-7-3-2-4-8-12/h2-4,7-8,11,13-14,16H,5-6,9-10H2,1H3/t11?,13-,14+/m0/s1 |
| InChIKey | WGNBWUZROWABDW-SBKAZOPESA-N |
| XLogP | 3.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |