C21H20N2OSe — CID 56669627
(3R)-1,3-diphenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one (PubChem CID 56669627) has the molecular formula C21H20N2OSe and a molecular weight of 395.36 g/mol. Its IUPAC name is (3R)-1,3-diphenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one.
| Compound Name | (3R)-1,3-diphenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 56669627 |
| Molecular Formula | C21H20N2OSe |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (3R)-1,3-diphenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
| SMILES | O=C(C[C@@H](c1ccccc1)[C@@H]1CCCc2[se]nnc21)c1ccccc1 |
| InChI | InChI=1S/C21H20N2OSe/c24-19(16-10-5-2-6-11-16)14-18(15-8-3-1-4-9-15)17-12-7-13-20-21(17)22-23-25-20/h1-6,8-11,17-18H,7,12-14H2/t17-,18-/m0/s1 |
| InChIKey | IDHSHRRTABDYJR-ROUUACIJSA-N |
| XLogP | 4.01 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|