C27H26O2 — CID 102426284
cis-(2S,6S)-2-[(1S)-3-oxo-1,3-diphenylpropyl]-6-phenylcyclohexan-1-one (PubChem CID 102426284) has the molecular formula C27H26O2 and a molecular weight of 382.50 g/mol. Its IUPAC name is cis-(2S,6S)-2-[(1S)-3-oxo-1,3-diphenylpropyl]-6-phenylcyclohexan-1-one.
| Compound Name | cis-(2S,6S)-2-[(1S)-3-oxo-1,3-diphenylpropyl]-6-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 102426284 |
| Molecular Formula | C27H26O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | cis-(2S,6S)-2-[(1S)-3-oxo-1,3-diphenylpropyl]-6-phenylcyclohexan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)[C@@H]1CCC[C@@H](c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H26O2/c28-26(22-15-8-3-9-16-22)19-25(21-13-6-2-7-14-21)24-18-10-17-23(27(24)29)20-11-4-1-5-12-20/h1-9,11-16,23-25H,10,17-19H2/t23-,24-,25+/m0/s1 |
| InChIKey | YFUUKRUDVQHXPZ-CCDWMCETSA-N |
| XLogP | 6.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |