C16H24ClNO — CID 114340592
2-(3-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyethanamine (PubChem CID 114340592) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyethanamine.
| Compound Name | 2-(3-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyethanamine |
|---|---|
| PubChem CID | 114340592 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-(3-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyethanamine |
| SMILES | CC1(C)CCC(OC(CN)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H24ClNO/c1-16(2)8-6-14(7-9-16)19-15(11-18)12-4-3-5-13(17)10-12/h3-5,10,14-15H,6-9,11,18H2,1-2H3 |
| InChIKey | BCYWJDMYPJYDFH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |