C17H25IO — CID 114775187
1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-3-methylbenzene (PubChem CID 114775187) has the molecular formula C17H25IO and a molecular weight of 372.29 g/mol. Its IUPAC name is 1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-3-methylbenzene.
| Compound Name | 1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-3-methylbenzene |
|---|---|
| PubChem CID | 114775187 |
| Molecular Formula | C17H25IO |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-3-methylbenzene |
| SMILES | Cc1cccc(C(CI)OC2CCC(C)(C)CC2)c1 |
| InChI | InChI=1S/C17H25IO/c1-13-5-4-6-14(11-13)16(12-18)19-15-7-9-17(2,3)10-8-15/h4-6,11,15-16H,7-10,12H2,1-3H3 |
| InChIKey | MZPOIQOZHSMGHH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|