C17H25IO2 — CID 114775179
1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-2-methoxybenzene (PubChem CID 114775179) has the molecular formula C17H25IO2 and a molecular weight of 388.29 g/mol. Its IUPAC name is 1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-2-methoxybenzene.
| Compound Name | 1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 114775179 |
| Molecular Formula | C17H25IO2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-[1-(4,4-dimethylcyclohexyl)oxy-2-iodoethyl]-2-methoxybenzene |
| SMILES | COc1ccccc1C(CI)OC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C17H25IO2/c1-17(2)10-8-13(9-11-17)20-16(12-18)14-6-4-5-7-15(14)19-3/h4-7,13,16H,8-12H2,1-3H3 |
| InChIKey | HURUUYBKYKZLGU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|