C17H26FNO2 — CID 67192571
(3R)-3-[(R)-3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine (PubChem CID 67192571) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is (3R)-3-[(R)-3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine.
| Compound Name | (3R)-3-[(R)-3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 67192571 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (3R)-3-[(R)-3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine |
| SMILES | CCOCCCO[C@@H](c1cccc(F)c1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C17H26FNO2/c1-2-20-10-5-11-21-17(15-7-4-9-19-13-15)14-6-3-8-16(18)12-14/h3,6,8,12,15,17,19H,2,4-5,7,9-11,13H2,1H3/t15-,17+/m1/s1 |
| InChIKey | DRBOOWFRMMTJRK-WBVHZDCISA-N |
| XLogP | 3.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|