C34H50F2N2O4 — CID 69468005
(3R)-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]-1-[5-[3-ethoxypropoxy-[(3R)-piperidin-3-yl]methyl]-2-fluorophenyl]piperidine (PubChem CID 69468005) has the molecular formula C34H50F2N2O4 and a molecular weight of 588.78 g/mol. Its IUPAC name is (3R)-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]-1-[5-[3-ethoxypropoxy-[(3R)-piperidin-3-yl]methyl]-2-fluorophenyl]piperidine.
| Compound Name | (3R)-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]-1-[5-[3-ethoxypropoxy-[(3R)-piperidin-3-yl]methyl]-2-fluorophenyl]piperidine |
|---|---|
| PubChem CID | 69468005 |
| Molecular Formula | C34H50F2N2O4 |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | (3R)-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]-1-[5-[3-ethoxypropoxy-[(3R)-piperidin-3-yl]methyl]-2-fluorophenyl]piperidine |
| SMILES | CCOCCCOC(c1ccc(F)c(N2CCC[C@@H](C(OCCCOCC)c3cccc(F)c3)C2)c1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C34H50F2N2O4/c1-3-39-18-8-20-41-33(28-11-6-16-37-24-28)27-14-15-31(36)32(23-27)38-17-7-12-29(25-38)34(42-21-9-19-40-4-2)26-10-5-13-30(35)22-26/h5,10,13-15,22-23,28-29,33-34,37H,3-4,6-9,11-12,16-21,24-25H2,1-2H3/t28-,29-,33?,34?/m1/s1 |
| InChIKey | MHMVARVBOVRHKA-ZAPYAPRUSA-N |
| XLogP | 6.85 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|