C33H52N2O4 — CID 69470017
3-[4-methoxybutoxy(phenyl)methyl]piperidine;4-methoxy-1-phenyl-1-piperidin-3-ylbutan-1-ol (PubChem CID 69470017) has the molecular formula C33H52N2O4 and a molecular weight of 540.79 g/mol. Its IUPAC name is 3-[4-methoxybutoxy(phenyl)methyl]piperidine;4-methoxy-1-phenyl-1-piperidin-3-ylbutan-1-ol.
| Compound Name | 3-[4-methoxybutoxy(phenyl)methyl]piperidine;4-methoxy-1-phenyl-1-piperidin-3-ylbutan-1-ol |
|---|---|
| PubChem CID | 69470017 |
| Molecular Formula | C33H52N2O4 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 3-[4-methoxybutoxy(phenyl)methyl]piperidine;4-methoxy-1-phenyl-1-piperidin-3-ylbutan-1-ol |
| SMILES | COCCCC(O)(c1ccccc1)C1CCCNC1.COCCCCOC(c1ccccc1)C1CCCNC1 |
| InChI | InChI=1S/C17H27NO2.C16H25NO2/c1-19-12-5-6-13-20-17(15-8-3-2-4-9-15)16-10-7-11-18-14-16;1-19-12-6-10-16(18,14-7-3-2-4-8-14)15-9-5-11-17-13-15/h2-4,8-9,16-18H,5-7,10-14H2,1H3;2-4,7-8,15,17-18H,5-6,9-13H2,1H3 |
| InChIKey | UUOFCTXKTSCFPA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|