C41H57N3O4 — CID 158206424
(3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine;(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-quinolin-8-ylpentan-1-ol (PubChem CID 158206424) has the molecular formula C41H57N3O4 and a molecular weight of 655.92 g/mol. Its IUPAC name is (3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine;(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-quinolin-8-ylpentan-1-ol.
| Compound Name | (3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine;(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-quinolin-8-ylpentan-1-ol |
|---|---|
| PubChem CID | 158206424 |
| Molecular Formula | C41H57N3O4 |
| Molecular Weight | 655.92 g/mol |
| Exact Mass | 655.43 |
| IUPAC Name | (3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine;(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-quinolin-8-ylpentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cccc2cccnc12)[C@@H]1CCCNC1.COCCCO[C@@H](c1ccccc1C#CC1CC1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C21H29NO2.C20H28N2O2/c1-23-14-5-15-24-21(19-7-4-13-22-16-19)20-8-3-2-6-18(20)12-11-17-9-10-17;1-24-14-3-2-11-20(23,17-9-6-12-21-15-17)18-10-4-7-16-8-5-13-22-19(16)18/h2-3,6,8,17,19,21-22H,4-5,7,9-10,13-16H2,1H3;4-5,7-8,10,13,17,21,23H,2-3,6,9,11-12,14-15H2,1H3/t19-,21-;17-,20+/m11/s1 |
| InChIKey | GBNYTAFAGRQZSZ-BVJLRWNASA-N |
| XLogP | 6.78 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.92 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|