C14H19F2NO2 — CID 70639511
2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethanol (PubChem CID 70639511) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethanol.
| Compound Name | 2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethanol |
|---|---|
| PubChem CID | 70639511 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethanol |
| SMILES | OCCOC(c1cccc(F)c1F)C1CCCNC1 |
| InChI | InChI=1S/C14H19F2NO2/c15-12-5-1-4-11(13(12)16)14(19-8-7-18)10-3-2-6-17-9-10/h1,4-5,10,14,17-18H,2-3,6-9H2 |
| InChIKey | RPLALJKEAHAQAH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |