C16H22F2N2O3 — CID 68715059
methyl N-[2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethyl]carbamate (PubChem CID 68715059) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl N-[2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 68715059 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | methyl N-[2-[(2,3-difluorophenyl)-piperidin-3-ylmethoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCOC(c1cccc(F)c1F)C1CCCNC1 |
| InChI | InChI=1S/C16H22F2N2O3/c1-22-16(21)20-8-9-23-15(11-4-3-7-19-10-11)12-5-2-6-13(17)14(12)18/h2,5-6,11,15,19H,3-4,7-10H2,1H3,(H,20,21) |
| InChIKey | RFQOFUKGLPOFFU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|