C19H26ClF3N2O5 — CID 68954194
methyl N-[2-[(R)-(5-chloro-2-methylphenyl)-[(3R)-piperidin-3-yl]methoxy]ethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 68954194) has the molecular formula C19H26ClF3N2O5 and a molecular weight of 454.87 g/mol. Its IUPAC name is methyl N-[2-[(R)-(5-chloro-2-methylphenyl)-[(3R)-piperidin-3-yl]methoxy]ethyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl N-[2-[(R)-(5-chloro-2-methylphenyl)-[(3R)-piperidin-3-yl]methoxy]ethyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68954194 |
| Molecular Formula | C19H26ClF3N2O5 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | methyl N-[2-[(R)-(5-chloro-2-methylphenyl)-[(3R)-piperidin-3-yl]methoxy]ethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)NCCO[C@@H](c1cc(Cl)ccc1C)[C@@H]1CCCNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25ClN2O3.C2HF3O2/c1-12-5-6-14(18)10-15(12)16(13-4-3-7-19-11-13)23-9-8-20-17(21)22-2;3-2(4,5)1(6)7/h5-6,10,13,16,19H,3-4,7-9,11H2,1-2H3,(H,20,21);(H,6,7)/t13-,16-;/m1./s1 |
| InChIKey | FCYYNCUUOPRZET-OALZAMAHSA-N |
| XLogP | 3.70 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|