C15H20ClFN2O3 — CID 68711452
2-[(3-chloro-2-fluorophenyl)-[(3R)-piperidin-3-yl]methoxy]ethylcarbamic acid (PubChem CID 68711452) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)-[(3R)-piperidin-3-yl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)-[(3R)-piperidin-3-yl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 68711452 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)-[(3R)-piperidin-3-yl]methoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOC(c1cccc(Cl)c1F)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C15H20ClFN2O3/c16-12-5-1-4-11(13(12)17)14(10-3-2-6-18-9-10)22-8-7-19-15(20)21/h1,4-5,10,14,18-19H,2-3,6-9H2,(H,20,21)/t10-,14?/m1/s1 |
| InChIKey | RGLFIGGDJIPGQB-IAPIXIRKSA-N |
| XLogP | 2.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|