C19H27ClFNO4 — CID 67191107
tert-butyl 3-[(3-chloro-2-fluorophenyl)-(2-hydroxyethoxy)methyl]piperidine-1-carboxylate (PubChem CID 67191107) has the molecular formula C19H27ClFNO4 and a molecular weight of 387.88 g/mol. Its IUPAC name is tert-butyl 3-[(3-chloro-2-fluorophenyl)-(2-hydroxyethoxy)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-chloro-2-fluorophenyl)-(2-hydroxyethoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67191107 |
| Molecular Formula | C19H27ClFNO4 |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl 3-[(3-chloro-2-fluorophenyl)-(2-hydroxyethoxy)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(OCCO)c2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C19H27ClFNO4/c1-19(2,3)26-18(24)22-9-5-6-13(12-22)17(25-11-10-23)14-7-4-8-15(20)16(14)21/h4,7-8,13,17,23H,5-6,9-12H2,1-3H3 |
| InChIKey | OSTYVRWDWJVHEF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |